Carboxylic acids and derivatives
Filtered Search Results
(1S,2R)-cis-4-Cyclohexene-1,2-dicarboxylic acid 1-monomethyl ester, 98%
CAS: 88335-93-7 Molecular Formula: C9H12O4 Molecular Weight (g/mol): 184.19 MDL Number: MFCD00757425,MFCD00075490 InChI Key: MYYLMIDEMAPSGH-UHFFFAOYNA-N Synonym: 1s,2r-1-methyl cis-1,2,3,6-tetrahydrophthalate,1r,6s-6-methoxycarbonyl cyclohex-3-enecarboxylic acid,1r,6s-6-methoxycarbonylcyclohex-3-ene-1-carboxylic acid,1r,6s-6-methoxycarbonyl cyclohex-3-ene-1-carboxylic acid,1s,2r-1-methyl cis-4-cyclohexene-1,2-dicarboxylate,1r,6s-6-methoxycarbonyl-1-cyclohex-3-enecarboxylic acid,1s,2r-1-methylcis-1,2,3,6-tetrahydrophthalate,2-hydrogen 1-methyl 1s,2r-1,2,3,6-tetrahydrophthalate,1 r,6s-6-methoxycarbonyl-3-cyclohexene-1-carboxylic acid,1r, 2s-2-methoxycarbonylcyclohex-4-ene-1-carboxylic acid PubChem CID: 5325907 IUPAC Name: (1R,6S)-6-methoxycarbonylcyclohex-3-ene-1-carboxylic acid SMILES: COC(=O)C1CC=CCC1C(O)=O
| PubChem CID | 5325907 |
|---|---|
| CAS | 88335-93-7 |
| Molecular Weight (g/mol) | 184.19 |
| MDL Number | MFCD00757425,MFCD00075490 |
| SMILES | COC(=O)C1CC=CCC1C(O)=O |
| Synonym | 1s,2r-1-methyl cis-1,2,3,6-tetrahydrophthalate,1r,6s-6-methoxycarbonyl cyclohex-3-enecarboxylic acid,1r,6s-6-methoxycarbonylcyclohex-3-ene-1-carboxylic acid,1r,6s-6-methoxycarbonyl cyclohex-3-ene-1-carboxylic acid,1s,2r-1-methyl cis-4-cyclohexene-1,2-dicarboxylate,1r,6s-6-methoxycarbonyl-1-cyclohex-3-enecarboxylic acid,1s,2r-1-methylcis-1,2,3,6-tetrahydrophthalate,2-hydrogen 1-methyl 1s,2r-1,2,3,6-tetrahydrophthalate,1 r,6s-6-methoxycarbonyl-3-cyclohexene-1-carboxylic acid,1r, 2s-2-methoxycarbonylcyclohex-4-ene-1-carboxylic acid |
| IUPAC Name | (1R,6S)-6-methoxycarbonylcyclohex-3-ene-1-carboxylic acid |
| InChI Key | MYYLMIDEMAPSGH-UHFFFAOYNA-N |
| Molecular Formula | C9H12O4 |
Spectrum Chemical Manufacturing Corporation Sodium Ascorbate, FCC, 99-101%, Spectrum™ Chemical
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
CAS: 134-03-2 Molecular Formula: C6H7NaO6 Molecular Weight (g/mol): 198.11 InChI Key: IFVCRSPJFHGFCG-HXPAKLQESA-N IUPAC Name: sodium 5-[(1S)-1,2-dihydroxyethyl]-3-hydroxy-2,4-dioxooxolan-3-ide SMILES: [Na+].OC[C@H](O)C1OC(=O)[C-](O)C1=O
| CAS | 134-03-2 |
|---|---|
| Molecular Weight (g/mol) | 198.11 |
| SMILES | [Na+].OC[C@H](O)C1OC(=O)[C-](O)C1=O |
| IUPAC Name | sodium 5-[(1S)-1,2-dihydroxyethyl]-3-hydroxy-2,4-dioxooxolan-3-ide |
| InChI Key | IFVCRSPJFHGFCG-HXPAKLQESA-N |
| Molecular Formula | C6H7NaO6 |
2-Aminoethyl methacrylate hydrochloride, 90%, stabilized
CAS: 2420-94-2 Molecular Formula: C6H11NO2·HCl Molecular Weight (g/mol): 165.62 MDL Number: MFCD00078260 InChI Key: XSHISXQEKIKSGC-UHFFFAOYSA-N Synonym: 2-aminoethyl methacrylate hydrochloride,2-aminoethylmethacrylate hydrochloride,2-aminoethyl 2-methylacrylate hydrochloride,methacrylic acid, 2-aminoethyl ester, hydrochloride, polymers,2-aminoethyl 2-methylprop-2-enoate hydrochloride,2-propenoic acid, 2-methyl-, 2-aminoethyl ester, hydrochloride 1:1,2-propenoic acid, 2-methyl-, 2-aminoethyl ester, hydrochloride,aminoethylmethacrylate,acmc-209wgm,timtec-bb sbb003905 PubChem CID: 75495 IUPAC Name: 2-aminoethyl 2-methylprop-2-enoate;hydrochloride SMILES: CC(=C)C(=O)OCCN.Cl
| PubChem CID | 75495 |
|---|---|
| CAS | 2420-94-2 |
| Molecular Weight (g/mol) | 165.62 |
| MDL Number | MFCD00078260 |
| SMILES | CC(=C)C(=O)OCCN.Cl |
| Synonym | 2-aminoethyl methacrylate hydrochloride,2-aminoethylmethacrylate hydrochloride,2-aminoethyl 2-methylacrylate hydrochloride,methacrylic acid, 2-aminoethyl ester, hydrochloride, polymers,2-aminoethyl 2-methylprop-2-enoate hydrochloride,2-propenoic acid, 2-methyl-, 2-aminoethyl ester, hydrochloride 1:1,2-propenoic acid, 2-methyl-, 2-aminoethyl ester, hydrochloride,aminoethylmethacrylate,acmc-209wgm,timtec-bb sbb003905 |
| IUPAC Name | 2-aminoethyl 2-methylprop-2-enoate;hydrochloride |
| InChI Key | XSHISXQEKIKSGC-UHFFFAOYSA-N |
| Molecular Formula | C6H11NO2·HCl |
(R)-2-Isopropylsuccinic acid-1-methyl ester, 95%, (98% ee), Thermo Scientific Chemicals
CAS: 220498-08-8 Molecular Formula: C8H14O4 Molecular Weight (g/mol): 174.19 MDL Number: MFCD01091030 InChI Key: VHOGSWBAPDPWTG-ZCFIWIBFSA-N Synonym: r-3-methoxycarbonyl-4-methylpentanoic acid,r-2-isopropyl-succinic acid-1-methyl ester,r-2-isopropylsuccinic acid-1-methyl ester,3r-3-methoxycarbonyl-4-methylpentanoic acid,2r-2-isopropylsuccinic acid 1-methyl ester,r---2-isopropylsuccinic acid 1-methyl ester,butanedioic acid,2-1-methylethyl-, 1-methyl ester, 2r PubChem CID: 5702634 IUPAC Name: (3R)-3-methoxycarbonyl-4-methylpentanoic acid SMILES: CC(C)C(CC(=O)O)C(=O)OC
| PubChem CID | 5702634 |
|---|---|
| CAS | 220498-08-8 |
| Molecular Weight (g/mol) | 174.19 |
| MDL Number | MFCD01091030 |
| SMILES | CC(C)C(CC(=O)O)C(=O)OC |
| Synonym | r-3-methoxycarbonyl-4-methylpentanoic acid,r-2-isopropyl-succinic acid-1-methyl ester,r-2-isopropylsuccinic acid-1-methyl ester,3r-3-methoxycarbonyl-4-methylpentanoic acid,2r-2-isopropylsuccinic acid 1-methyl ester,r---2-isopropylsuccinic acid 1-methyl ester,butanedioic acid,2-1-methylethyl-, 1-methyl ester, 2r |
| IUPAC Name | (3R)-3-methoxycarbonyl-4-methylpentanoic acid |
| InChI Key | VHOGSWBAPDPWTG-ZCFIWIBFSA-N |
| Molecular Formula | C8H14O4 |
Methyl indole-2-carboxylate, 97%
CAS: 1202-04-6 Molecular Formula: C10H9NO2 Molecular Weight (g/mol): 175.19 MDL Number: MFCD00460779 InChI Key: NQPIEWBAWBFGOB-UHFFFAOYSA-N Synonym: methyl indole-2-carboxylate,indole-2-carboxylic acid methyl ester,methyl 2-indolecarboxylate,1h-indole-2-carboxylic acid methyl ester,1h-indole-2-carboxylic acid, methyl ester,ethyl-indole-2-caboxylate,pubchem7284,2-methoxycarbonylindole,methylindole-2-carboxylate,buttpark 99\04-61 PubChem CID: 70992 IUPAC Name: methyl 1H-indole-2-carboxylate SMILES: COC(=O)C1=CC2=CC=CC=C2N1
| PubChem CID | 70992 |
|---|---|
| CAS | 1202-04-6 |
| Molecular Weight (g/mol) | 175.19 |
| MDL Number | MFCD00460779 |
| SMILES | COC(=O)C1=CC2=CC=CC=C2N1 |
| Synonym | methyl indole-2-carboxylate,indole-2-carboxylic acid methyl ester,methyl 2-indolecarboxylate,1h-indole-2-carboxylic acid methyl ester,1h-indole-2-carboxylic acid, methyl ester,ethyl-indole-2-caboxylate,pubchem7284,2-methoxycarbonylindole,methylindole-2-carboxylate,buttpark 99\04-61 |
| IUPAC Name | methyl 1H-indole-2-carboxylate |
| InChI Key | NQPIEWBAWBFGOB-UHFFFAOYSA-N |
| Molecular Formula | C10H9NO2 |
Methyl chloroacetate, 98%
CAS: 96-34-4 Molecular Formula: C3H5ClO2 Molecular Weight (g/mol): 108.52 MDL Number: MFCD00000931 InChI Key: QABLOFMHHSOFRJ-UHFFFAOYSA-N Synonym: methyl chloroacetate,chloroacetic acid methyl ester,methyl monochloroacetate,methyl chloroethanoate,acetic acid, chloro-, methyl ester,methyl monochloracetate,methyl alpha-chloroacetate,methylchloroacetate,unii-450vsb182i,ccris 7749 PubChem CID: 7295 IUPAC Name: methyl 2-chloroacetate SMILES: COC(=O)CCl
| PubChem CID | 7295 |
|---|---|
| CAS | 96-34-4 |
| Molecular Weight (g/mol) | 108.52 |
| MDL Number | MFCD00000931 |
| SMILES | COC(=O)CCl |
| Synonym | methyl chloroacetate,chloroacetic acid methyl ester,methyl monochloroacetate,methyl chloroethanoate,acetic acid, chloro-, methyl ester,methyl monochloracetate,methyl alpha-chloroacetate,methylchloroacetate,unii-450vsb182i,ccris 7749 |
| IUPAC Name | methyl 2-chloroacetate |
| InChI Key | QABLOFMHHSOFRJ-UHFFFAOYSA-N |
| Molecular Formula | C3H5ClO2 |
Methyl oxalyl chloride, 97%
CAS: 5781-53-3 Molecular Formula: C3H3ClO3 Molecular Weight (g/mol): 122.51 MDL Number: MFCD00000705 InChI Key: ZXUQEPZWVQIOJE-UHFFFAOYSA-N Synonym: methyl oxalyl chloride,methyl chloroglyoxylate,methyl chlorooxoacetate,chloroglyoxylic acid methyl ester,acetic acid, chlorooxo-, methyl ester,methyl chlorocarbonyl formate,methyloxalylchloride,methyl chloro oxo acetate,methylchlorooxoacetate,methyl 2-chloro-2-oxo-acetate PubChem CID: 79846 IUPAC Name: methyl 2-chloro-2-oxoacetate SMILES: COC(=O)C(=O)Cl
| PubChem CID | 79846 |
|---|---|
| CAS | 5781-53-3 |
| Molecular Weight (g/mol) | 122.51 |
| MDL Number | MFCD00000705 |
| SMILES | COC(=O)C(=O)Cl |
| Synonym | methyl oxalyl chloride,methyl chloroglyoxylate,methyl chlorooxoacetate,chloroglyoxylic acid methyl ester,acetic acid, chlorooxo-, methyl ester,methyl chlorocarbonyl formate,methyloxalylchloride,methyl chloro oxo acetate,methylchlorooxoacetate,methyl 2-chloro-2-oxo-acetate |
| IUPAC Name | methyl 2-chloro-2-oxoacetate |
| InChI Key | ZXUQEPZWVQIOJE-UHFFFAOYSA-N |
| Molecular Formula | C3H3ClO3 |
Methyl 2,2-dimethylacetoacetate, 99%
CAS: 38923-57-8 Molecular Formula: C7H12O3 Molecular Weight (g/mol): 144.17 MDL Number: MFCD00026232 InChI Key: LVSDLZIEHYYLTC-UHFFFAOYSA-N Synonym: methyl 2,2-dimethylacetoacetate,methyl2,2-dimethylacetoacetate,butanoic acid, 2,2-dimethyl-3-oxo-, methyl ester,methyl 2,2-dimethyl acetoacetate,2,2-dimethylacetoacetic acid methyl ester,2,2-dimethyl-3-oxo-butyric acid methyl ester,2,2-dimethyl-3-oxobutyric acid, methyl ester,methyl 2,2-dimethyl-3-oxobutyrate,pubchem23356,acmc-20akj7 PubChem CID: 96925 IUPAC Name: methyl 2,2-dimethyl-3-oxobutanoate SMILES: COC(=O)C(C)(C)C(C)=O
| PubChem CID | 96925 |
|---|---|
| CAS | 38923-57-8 |
| Molecular Weight (g/mol) | 144.17 |
| MDL Number | MFCD00026232 |
| SMILES | COC(=O)C(C)(C)C(C)=O |
| Synonym | methyl 2,2-dimethylacetoacetate,methyl2,2-dimethylacetoacetate,butanoic acid, 2,2-dimethyl-3-oxo-, methyl ester,methyl 2,2-dimethyl acetoacetate,2,2-dimethylacetoacetic acid methyl ester,2,2-dimethyl-3-oxo-butyric acid methyl ester,2,2-dimethyl-3-oxobutyric acid, methyl ester,methyl 2,2-dimethyl-3-oxobutyrate,pubchem23356,acmc-20akj7 |
| IUPAC Name | methyl 2,2-dimethyl-3-oxobutanoate |
| InChI Key | LVSDLZIEHYYLTC-UHFFFAOYSA-N |
| Molecular Formula | C7H12O3 |
Ethyl propiolate, 99%
CAS: 623-47-2 Molecular Formula: C5H6O2 Molecular Weight (g/mol): 98.10 MDL Number: MFCD00009184 InChI Key: FMVJYQGSRWVMQV-UHFFFAOYSA-N Synonym: ethyl propiolate,ethyl acetylenecarboxylate,2-propynoic acid, ethyl ester,propiolic acid ethyl ester,ethyl propynoate,ethoxycarbonyl acetylene,ethyl 2-propynoate,propiolic acid, ethyl ester,unii-w235g5u52s,propynoic acid ethyl ester PubChem CID: 12182 ChEBI: CHEBI:51740 IUPAC Name: ethyl prop-2-ynoate SMILES: CCOC(=O)C#C
| PubChem CID | 12182 |
|---|---|
| CAS | 623-47-2 |
| Molecular Weight (g/mol) | 98.10 |
| ChEBI | CHEBI:51740 |
| MDL Number | MFCD00009184 |
| SMILES | CCOC(=O)C#C |
| Synonym | ethyl propiolate,ethyl acetylenecarboxylate,2-propynoic acid, ethyl ester,propiolic acid ethyl ester,ethyl propynoate,ethoxycarbonyl acetylene,ethyl 2-propynoate,propiolic acid, ethyl ester,unii-w235g5u52s,propynoic acid ethyl ester |
| IUPAC Name | ethyl prop-2-ynoate |
| InChI Key | FMVJYQGSRWVMQV-UHFFFAOYSA-N |
| Molecular Formula | C5H6O2 |
Methyl 4,4,4-trifluorocrotonate, 97%
CAS: 85694-31-1 Molecular Formula: C5H5F3O2 Molecular Weight (g/mol): 154.09 MDL Number: MFCD00077567 InChI Key: DMMZYYLXAGRBDO-NSCUHMNNSA-N Synonym: methyl 4,4,4-trifluorocrotonate,methyl 2e-4,4,4-trifluorobut-2-enoate,methyl4,4,4-trifluorocrotonate,methyl e-3-trifluoromethyl propenoate,e-methyl 4,4,4-trifluorobut-2-enoate,methyl 4,4,4-trifluorobut-2-enoate,heddpndiaicichibemultbb`,methyl 4,4,4-trifluorocrotonat,methyl e-4,4,4-trifluorobut-2-enoate,4,4,4-trifluorocrotonic acid methyl ester PubChem CID: 5371282 IUPAC Name: methyl (E)-4,4,4-trifluorobut-2-enoate SMILES: COC(=O)\C=C\C(F)(F)F
| PubChem CID | 5371282 |
|---|---|
| CAS | 85694-31-1 |
| Molecular Weight (g/mol) | 154.09 |
| MDL Number | MFCD00077567 |
| SMILES | COC(=O)\C=C\C(F)(F)F |
| Synonym | methyl 4,4,4-trifluorocrotonate,methyl 2e-4,4,4-trifluorobut-2-enoate,methyl4,4,4-trifluorocrotonate,methyl e-3-trifluoromethyl propenoate,e-methyl 4,4,4-trifluorobut-2-enoate,methyl 4,4,4-trifluorobut-2-enoate,heddpndiaicichibemultbb`,methyl 4,4,4-trifluorocrotonat,methyl e-4,4,4-trifluorobut-2-enoate,4,4,4-trifluorocrotonic acid methyl ester |
| IUPAC Name | methyl (E)-4,4,4-trifluorobut-2-enoate |
| InChI Key | DMMZYYLXAGRBDO-NSCUHMNNSA-N |
| Molecular Formula | C5H5F3O2 |
Methyl 4-bromocrotonate, tech. 85%
CAS: 1117-71-1 Molecular Formula: C5H7BrO2 Molecular Weight (g/mol): 179.01 MDL Number: MFCD00000246,MFCD09998308 InChI Key: RWIKCBHOVNDESJ-NSCUHMNNSA-N Synonym: methyl 4-bromocrotonate,e-methyl 4-bromobut-2-enoate,4-bromocrotonic acid methyl ester,methyl gamma-bromocrotonate,methyl bromocrotonate,methyl 4-bromo-2-butenoate,2-butenoic acid, 4-bromo-, methyl ester,methyl 4-bromobut-2-enoate,methyl 2e-4-bromobut-2-enoate,crotonic acid, 4-bromo-, methyl ester PubChem CID: 5369175 IUPAC Name: methyl (E)-4-bromobut-2-enoate SMILES: COC(=O)\C=C\CBr
| PubChem CID | 5369175 |
|---|---|
| CAS | 1117-71-1 |
| Molecular Weight (g/mol) | 179.01 |
| MDL Number | MFCD00000246,MFCD09998308 |
| SMILES | COC(=O)\C=C\CBr |
| Synonym | methyl 4-bromocrotonate,e-methyl 4-bromobut-2-enoate,4-bromocrotonic acid methyl ester,methyl gamma-bromocrotonate,methyl bromocrotonate,methyl 4-bromo-2-butenoate,2-butenoic acid, 4-bromo-, methyl ester,methyl 4-bromobut-2-enoate,methyl 2e-4-bromobut-2-enoate,crotonic acid, 4-bromo-, methyl ester |
| IUPAC Name | methyl (E)-4-bromobut-2-enoate |
| InChI Key | RWIKCBHOVNDESJ-NSCUHMNNSA-N |
| Molecular Formula | C5H7BrO2 |
Methyl trimethylacetate, 99%
CAS: 598-98-1 Molecular Formula: C6H12O2 Molecular Weight (g/mol): 116.16 MDL Number: MFCD00008843 InChI Key: CNMFHDIDIMZHKY-UHFFFAOYSA-N Synonym: methyl pivalate,methyl trimethylacetate,propanoic acid, 2,2-dimethyl-, methyl ester,pivalic acid, methyl ester,unii-bfx9w386ox,bfx9w386ox,pivalic acid methyl ester,methyl pivaloate,methyltrimethylacetate,tert-c4h9cooch3 PubChem CID: 69027 IUPAC Name: methyl 2,2-dimethylpropanoate SMILES: CC(C)(C)C(=O)OC
| PubChem CID | 69027 |
|---|---|
| CAS | 598-98-1 |
| Molecular Weight (g/mol) | 116.16 |
| MDL Number | MFCD00008843 |
| SMILES | CC(C)(C)C(=O)OC |
| Synonym | methyl pivalate,methyl trimethylacetate,propanoic acid, 2,2-dimethyl-, methyl ester,pivalic acid, methyl ester,unii-bfx9w386ox,bfx9w386ox,pivalic acid methyl ester,methyl pivaloate,methyltrimethylacetate,tert-c4h9cooch3 |
| IUPAC Name | methyl 2,2-dimethylpropanoate |
| InChI Key | CNMFHDIDIMZHKY-UHFFFAOYSA-N |
| Molecular Formula | C6H12O2 |
Methyl 4-methoxyindole-2-carboxylate, 99%
CAS: 111258-23-2 Molecular Formula: C11H11NO3 Molecular Weight (g/mol): 205.21 MDL Number: MFCD00134300 InChI Key: GLCZQTLCVLVFGV-UHFFFAOYSA-N Synonym: methyl 4-methoxy-2-indolecarboxylate,4-methoxy-1h-indole-2-carboxylic acid methyl ester,methyl 4-methoxyindole-2-carboxylate,1h-indole-2-carboxylic acid, 4-methoxy-, methyl ester,4-methoxyindole-2-carboxylic acid methyl ester,methyl-4-methoxy-2-indolecarboxylate,1h-indole-2-carboxylicacid, 4-methoxy-, methyl ester,methyl4-methoxy-2-indolecarboxylate,pubchem7250,acmc-1btz2 PubChem CID: 688172 IUPAC Name: methyl 4-methoxy-1H-indole-2-carboxylate SMILES: COC(=O)C1=CC2=C(OC)C=CC=C2N1
| PubChem CID | 688172 |
|---|---|
| CAS | 111258-23-2 |
| Molecular Weight (g/mol) | 205.21 |
| MDL Number | MFCD00134300 |
| SMILES | COC(=O)C1=CC2=C(OC)C=CC=C2N1 |
| Synonym | methyl 4-methoxy-2-indolecarboxylate,4-methoxy-1h-indole-2-carboxylic acid methyl ester,methyl 4-methoxyindole-2-carboxylate,1h-indole-2-carboxylic acid, 4-methoxy-, methyl ester,4-methoxyindole-2-carboxylic acid methyl ester,methyl-4-methoxy-2-indolecarboxylate,1h-indole-2-carboxylicacid, 4-methoxy-, methyl ester,methyl4-methoxy-2-indolecarboxylate,pubchem7250,acmc-1btz2 |
| IUPAC Name | methyl 4-methoxy-1H-indole-2-carboxylate |
| InChI Key | GLCZQTLCVLVFGV-UHFFFAOYSA-N |
| Molecular Formula | C11H11NO3 |
trans-Methyl crotonate, 96%
CAS: 623-43-8 Molecular Formula: C5H8O2 Molecular Weight (g/mol): 100.12 MDL Number: MFCD00009287 InChI Key: MCVVUJPXSBQTRZ-ONEGZZNKSA-N Synonym: methyl crotonate,e-methyl but-2-enoate,trans-methyl crotonate,methyl e-crotonate,methyl 2-butenoate,methyl trans-crotonate,2-butenoic acid, methyl ester, 2e,trans-2-butenoic acid methyl ester,methyl trans-2-butenoate,e-crotonic acid methyl ester PubChem CID: 638132 SMILES: COC(=O)\C=C\C
| PubChem CID | 638132 |
|---|---|
| CAS | 623-43-8 |
| Molecular Weight (g/mol) | 100.12 |
| MDL Number | MFCD00009287 |
| SMILES | COC(=O)\C=C\C |
| Synonym | methyl crotonate,e-methyl but-2-enoate,trans-methyl crotonate,methyl e-crotonate,methyl 2-butenoate,methyl trans-crotonate,2-butenoic acid, methyl ester, 2e,trans-2-butenoic acid methyl ester,methyl trans-2-butenoate,e-crotonic acid methyl ester |
| InChI Key | MCVVUJPXSBQTRZ-ONEGZZNKSA-N |
| Molecular Formula | C5H8O2 |
Diethyl acetylenedicarboxylate, 96%
CAS: 762-21-0 Molecular Formula: C8H10O4 Molecular Weight (g/mol): 170.164 MDL Number: MFCD00009186 InChI Key: STRNXFOUBFLVIN-UHFFFAOYSA-N Synonym: diethyl acetylenedicarboxylate,2-butynedioic acid, diethyl ester,diethyl 2-butynedioate,1,4-diethyl but-2-ynedioate,acetylenedicarboxylic acid, diethyl ester,acetylenedicarboxylic acid diethyl ester,diethylacetylenedicarboxylate,bis-ethoxycarbonyl acetylene,diethyl acetylene dicarboxylate,di-ethyl acetylenedicarboxylate PubChem CID: 69803 IUPAC Name: diethyl but-2-ynedioate SMILES: CCOC(=O)C#CC(=O)OCC
| PubChem CID | 69803 |
|---|---|
| CAS | 762-21-0 |
| Molecular Weight (g/mol) | 170.164 |
| MDL Number | MFCD00009186 |
| SMILES | CCOC(=O)C#CC(=O)OCC |
| Synonym | diethyl acetylenedicarboxylate,2-butynedioic acid, diethyl ester,diethyl 2-butynedioate,1,4-diethyl but-2-ynedioate,acetylenedicarboxylic acid, diethyl ester,acetylenedicarboxylic acid diethyl ester,diethylacetylenedicarboxylate,bis-ethoxycarbonyl acetylene,diethyl acetylene dicarboxylate,di-ethyl acetylenedicarboxylate |
| IUPAC Name | diethyl but-2-ynedioate |
| InChI Key | STRNXFOUBFLVIN-UHFFFAOYSA-N |
| Molecular Formula | C8H10O4 |